CAS 364-51-2 is the registry number for 3-Fluoro-6-nitrobenzoic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.
Ethyl 5-fluoro-2-nitrobenzoate (CAS 364-51-2) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 5-fluoro-2-nitrobenzoate. InChIKey: LNFCVLHYTOGQEK-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 5-fluoro-2-nitrobenzoate |
| InChIKey | LNFCVLHYTOGQEK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)