Products 36403-68-6
CAS 36403-68-6 is the registry number for δ9–THC methyl ether. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(6aR,10aR)-1-methoxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene (CAS 36403-68-6) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 328.5 g/mol. IUPAC name: (6aR,10aR)-1-methoxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene. InChIKey: FJRQDVCLUUZSIG-QZTJIDSGSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | (6aR,10aR)-1-methoxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene |
| InChIKey | FJRQDVCLUUZSIG-QZTJIDSGSA-N |
| SMILES | CCCCCC1=CC2=C([C@@H]3C=C(CC[C@H]3C(O2)(C)C)C)C(=C1)OC |
Computed by PubChem (NCBI)