CAS 364039-56-5 is the registry number for TNF-α-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[7-methoxy-2-(3,4,5-trimethoxyphenyl)-2H-chromen-3-yl]ethanone (CAS 364039-56-5) is a chemical compound with the molecular formula C21H22O6 and a molecular weight of 370.4 g/mol. IUPAC name: 1-[7-methoxy-2-(3,4,5-trimethoxyphenyl)-2H-chromen-3-yl]ethanone. InChIKey: XCEBILOQMYIRDM-UHFFFAOYSA-N.
| Molecular formula | C21H22O6 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 1-[7-methoxy-2-(3,4,5-trimethoxyphenyl)-2H-chromen-3-yl]ethanone |
| InChIKey | XCEBILOQMYIRDM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C(C=C2)OC)OC1C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)