CAS 364039-60-1 is the registry number for TNF-α-IN-16. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-methoxy-2-(3,4,5-trimethoxyphenyl)-2H-chromene-3-carbonitrile (CAS 364039-60-1) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: 7-methoxy-2-(3,4,5-trimethoxyphenyl)-2H-chromene-3-carbonitrile. InChIKey: MGSHDHPTWIYEQZ-UHFFFAOYSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 7-methoxy-2-(3,4,5-trimethoxyphenyl)-2H-chromene-3-carbonitrile |
| InChIKey | MGSHDHPTWIYEQZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C(O2)C3=CC(=C(C(=C3)OC)OC)OC)C#N |
Computed by PubChem (NCBI)