Products 364607-53-4

CAS 364607-53-4 is the registry number for N-BOC 2-Bromo-4-methylaniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-bromo-4-methylphenyl)carbamate (CAS 364607-53-4) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: tert-butyl N-(2-bromo-4-methylphenyl)carbamate. InChIKey: PMCPXFWJWZNKJK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16BrNO2
Molecular weight286.16 g/mol
IUPAC nametert-butyl N-(2-bromo-4-methylphenyl)carbamate
InChIKeyPMCPXFWJWZNKJK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)NC(=O)OC(C)(C)C)Br

Computed by PubChem (NCBI)