CAS 36531-08-5 appears in our catalog under these names: Guaiacin, 99%, Guaiacin, Guaiacin, 99%, 99%, Guaiacin, 99.92%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 1mg, 5mg, 5 mg, 10 mg.
(6R,7S,8S)-8-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol (CAS 36531-08-5) is a chemical compound with the molecular formula C20H24O4 and a molecular weight of 328.4 g/mol. IUPAC name: (6R,7S,8S)-8-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol. InChIKey: TZAAYUCUPIYQBR-JGRMJRGVSA-N.
| Molecular formula | C20H24O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (6R,7S,8S)-8-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| InChIKey | TZAAYUCUPIYQBR-JGRMJRGVSA-N |
| SMILES | C[C@@H]1CC2=CC(=C(C=C2[C@@H]([C@H]1C)C3=CC(=C(C=C3)O)OC)O)OC |
Computed by PubChem (NCBI)