CAS 191036-43-8 appears in our catalog under these names: (2S,3R,5S)-2,3-Bis(benzyloxy)-5-hydroxyhexanal, 98%, 2,3-Di-O-benzyl-4-deoxy-L-fucose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg.
(2S,3R,5S)-5-hydroxy-2,3-bis(phenylmethoxy)hexanal (CAS 191036-43-8) is a chemical compound with the molecular formula C20H24O4 and a molecular weight of 328.4 g/mol. IUPAC name: (2S,3R,5S)-5-hydroxy-2,3-bis(phenylmethoxy)hexanal. InChIKey: HPXCJXHFGHRRIS-PWIZWCRZSA-N.
| Molecular formula | C20H24O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (2S,3R,5S)-5-hydroxy-2,3-bis(phenylmethoxy)hexanal |
| InChIKey | HPXCJXHFGHRRIS-PWIZWCRZSA-N |
| SMILES | C[C@@H](C[C@H]([C@@H](C=O)OCC1=CC=CC=C1)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)