Products 39461-20-6
CAS 39461-20-6 is the registry number for Nigellone. Offered by: Chemat Brand. Available pack sizes: on request.
4b,8b-dimethyl-3,7-di(propan-2-yl)-4a,8a-dihydrobiphenylene-1,4,5,8-tetrone (CAS 39461-20-6) is a chemical compound with the molecular formula C20H24O4 and a molecular weight of 328.4 g/mol. IUPAC name: 4b,8b-dimethyl-3,7-di(propan-2-yl)-4a,8a-dihydrobiphenylene-1,4,5,8-tetrone. InChIKey: FPRGRROJPRIHJP-UHFFFAOYSA-N.
| Molecular formula | C20H24O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 4b,8b-dimethyl-3,7-di(propan-2-yl)-4a,8a-dihydrobiphenylene-1,4,5,8-tetrone |
| InChIKey | FPRGRROJPRIHJP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)C2(C(C1=O)C3(C2C(=O)C(=CC3=O)C(C)C)C)C |
Computed by PubChem (NCBI)