Products 36585-31-6

CAS 36585-31-6 is the registry number for Ropivacaine Impurity 36. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(3R,10R)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione (CAS 36585-31-6) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: (3R,10R)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione. InChIKey: DVUOUKHMQDFLFQ-NXEZZACHSA-N.

Identity
Molecular formulaC12H18N2O2
Molecular weight222.28 g/mol
IUPAC name(3R,10R)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione
InChIKeyDVUOUKHMQDFLFQ-NXEZZACHSA-N
SMILESC1CCN2[C@H](C1)C(=O)N3CCCC[C@@H]3C2=O

Computed by PubChem (NCBI)