Products 36588-46-2
CAS 36588-46-2 appears in our catalog under these names: Ropivacaine Impurity 35, trans-Octahydrodipyrido[1,2-a:1',2'-d]pyrazine-6,12(2H,6aH)-dione, 97%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
(3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione (CAS 36588-46-2) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione. InChIKey: DVUOUKHMQDFLFQ-AOOOYVTPSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | (3R,10S)-1,8-diazatricyclo[8.4.0.03,8]tetradecane-2,9-dione |
| InChIKey | DVUOUKHMQDFLFQ-AOOOYVTPSA-N |
| SMILES | C1CCN2[C@H](C1)C(=O)N3CCCC[C@H]3C2=O |
Computed by PubChem (NCBI)