CAS 365996-12-9 is the registry number for Edoxaban Impurity 48. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylate (CAS 365996-12-9) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: methyl 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylate. InChIKey: DPCQCQNPHQUXCC-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | methyl 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylate |
| InChIKey | DPCQCQNPHQUXCC-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)SC(=N2)C(=O)OC |
Computed by PubChem (NCBI)