Products 36669-06-4

CAS 36669-06-4 is the registry number for Dimethyl 2-Hydroxyisophthalate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 2-hydroxybenzene-1,3-dicarboxylate (CAS 36669-06-4) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 2-hydroxybenzene-1,3-dicarboxylate. InChIKey: HJZOAEXBCOTMIU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O5
Molecular weight210.18 g/mol
IUPAC namedimethyl 2-hydroxybenzene-1,3-dicarboxylate
InChIKeyHJZOAEXBCOTMIU-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC=C1)C(=O)OC)O

Computed by PubChem (NCBI)