CAS 36669-06-4 is the registry number for Dimethyl 2-Hydroxyisophthalate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
Dimethyl 2-hydroxybenzene-1,3-dicarboxylate (CAS 36669-06-4) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 2-hydroxybenzene-1,3-dicarboxylate. InChIKey: HJZOAEXBCOTMIU-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 2-hydroxybenzene-1,3-dicarboxylate |
| InChIKey | HJZOAEXBCOTMIU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(=O)OC)O |
Computed by PubChem (NCBI)