Products 367-79-3
CAS 367-79-3 appears in our catalog under these names: Ethyl 2-fluoro-5-nitrobenzoate, 98%, Ethyl 2-fluoro-5-nitrobenzoate 98%, Ethyl 2-fluoro-5-nitrobenzoate, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 1g.
Ethyl 2-fluoro-5-nitrobenzoate (CAS 367-79-3) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 2-fluoro-5-nitrobenzoate. InChIKey: UJIPWFPJAVYMHV-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 2-fluoro-5-nitrobenzoate |
| InChIKey | UJIPWFPJAVYMHV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)