CAS 367-80-6 appears in our catalog under these names: Ethyl 4–fluoro–3–nitrobenzoate, Ethyl 4-Fluoro-3-nitrobenzoate, Ethyl 4-fluoro-3-nitrobenzoate 98%, Benzoic acid, 4-fluoro-3-nitro-, ethyl ester, 98%, 98%, Ethyl 4-Fluoro-3-nitrobenzoate, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 50g, 250g, 1g, 5g, 10g, 500g.
Ethyl 4-fluoro-3-nitrobenzoate (CAS 367-80-6) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 4-fluoro-3-nitrobenzoate. InChIKey: YONVBKVUSUGBQR-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 4-fluoro-3-nitrobenzoate |
| InChIKey | YONVBKVUSUGBQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)