CAS 3671-65-6 is the registry number for 6-Methoxy-2-(trifluoromethyl)-1H-benzo[d]imidazole, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
6-methoxy-2-(trifluoromethyl)-1H-benzimidazole (CAS 3671-65-6) is a chemical compound with the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. IUPAC name: 6-methoxy-2-(trifluoromethyl)-1H-benzimidazole. InChIKey: GPYQJBAVCKSQTJ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 6-methoxy-2-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | GPYQJBAVCKSQTJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)