CAS 36729-27-8 appears in our catalog under these names: 2,3,4,9-Tetrahydro-1h-carbazole-6-carboxylic acid, 95%, 2,3,4,9–Tetrahydro–1H–carbazole–6–carboxylic acid, 6,7,8,9-Tetrahydro-5H-carbazole-3-carboxylic acid, 6,7,8,9-Tetrahydro-5H-carbazole-3-carboxylic acid, 97% , 2,3,4,9-Tetrahydro-1H-carbazole-6-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific, Chemat. Available pack sizes: 1g, 100mg, 5g, 250MG.
6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid (CAS 36729-27-8) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid. InChIKey: OWQQDAGRTDUORV-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid |
| InChIKey | OWQQDAGRTDUORV-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)