CAS 367501-32-4 appears in our catalog under these names: 3–Ethoxy–4–nitrobenzoic acid, 3-Ethoxy-4-nitrobenzoic acid 95%, 3-ETHOXY-4-NITROBENZOIC ACID, 98%, 3-Ethoxy-4-nitrobenzoic acid, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-ethoxy-4-nitrobenzoic acid (CAS 367501-32-4) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 3-ethoxy-4-nitrobenzoic acid. InChIKey: ZWPRGHWABASJLH-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 3-ethoxy-4-nitrobenzoic acid |
| InChIKey | ZWPRGHWABASJLH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)