CAS 36752-40-6 appears in our catalog under these names: 5-Chloro Clonixin, Clonixin Impurity 2, p-Chlonixin, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 500mg, 50mg.
2-(5-chloro-2-methylanilino)pyridine-3-carboxylic acid (CAS 36752-40-6) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 2-(5-chloro-2-methylanilino)pyridine-3-carboxylic acid. InChIKey: TUBJXQUGYCLPGM-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-(5-chloro-2-methylanilino)pyridine-3-carboxylic acid |
| InChIKey | TUBJXQUGYCLPGM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)NC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)