CAS 3676-85-5 appears in our catalog under these names: 5-Aminoisoindoline-1,3-dione, 97%, 5-Amino-isoindole-1,3-dione, 98%, 4-Aminophthalimide, 96%, 4–Aminophthalimide, 4-Aminophthalimide, 97% . Offered by: Chemat Brand, Fluorochem, Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 1g, 5g, 25g, 50g, 100g, 500g, 10g.
5-aminoisoindole-1,3-dione (CAS 3676-85-5) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 5-aminoisoindole-1,3-dione. InChIKey: PXRKCOCTEMYUEG-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-aminoisoindole-1,3-dione |
| InChIKey | PXRKCOCTEMYUEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)NC2=O |
Computed by PubChem (NCBI)