Products 36760-44-8
CAS 36760-44-8 is the registry number for D-(+)-Tryptophan hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2-amino-3-(1H-indol-3-yl)propanoic acid;hydrochloride (CAS 36760-44-8) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid;hydrochloride. InChIKey: GTVXHTBGOYJORD-SBSPUUFOSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid;hydrochloride |
| InChIKey | GTVXHTBGOYJORD-SBSPUUFOSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)