CAS 36764-94-0 appears in our catalog under these names: 2–Amino–3,5–dichlorobenzonitrile, 2-Amino-3,5-dichlorobenzonitrile, >98.0%(GC), 2-Amino-3,5-dichlorobenzonitrile 98%, 2-Amino-3,5-dichlorobenzonitrile, 98%, 98%, 2-Amino-3,5-dichlorobenzonitrile, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
2-amino-3,5-dichlorobenzonitrile (CAS 36764-94-0) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2-amino-3,5-dichlorobenzonitrile. InChIKey: ZHKNDJRPOVUPMT-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2-amino-3,5-dichlorobenzonitrile |
| InChIKey | ZHKNDJRPOVUPMT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)N)Cl)Cl |
Computed by PubChem (NCBI)