CAS 36825-36-2 appears in our catalog under these names: 4–Amino–3–bromoquinoline, 4-Amino-3-bromoquinoline 95%, 4-Amino-3-bromoquinoline, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-bromoquinolin-4-amine (CAS 36825-36-2) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 3-bromoquinolin-4-amine. InChIKey: TYGUEEGQSYNEHB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 3-bromoquinolin-4-amine |
| InChIKey | TYGUEEGQSYNEHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C=N2)Br)N |
Computed by PubChem (NCBI)