CAS 369363-56-4 is the registry number for 4-(2-Fluorophenyl)-1H-1,2,3-triazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(2-fluorophenyl)-2H-triazole (CAS 369363-56-4) is a chemical compound with the molecular formula C8H6FN3 and a molecular weight of 163.15 g/mol. IUPAC name: 4-(2-fluorophenyl)-2H-triazole. InChIKey: XQNLLPNGLMIYRT-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3 |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-2H-triazole |
| InChIKey | XQNLLPNGLMIYRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNN=C2)F |
Computed by PubChem (NCBI)