CAS 369403-56-5 is the registry number for rac-alpha-N-Boc-Amino-4-pyridineaceic Acid. Offered by: TRC. Available pack sizes: 100mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridin-4-ylacetic acid (CAS 369403-56-5) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridin-4-ylacetic acid. InChIKey: MHUNKOGKEZKMBI-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridin-4-ylacetic acid |
| InChIKey | MHUNKOGKEZKMBI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=NC=C1)C(=O)O |
Computed by PubChem (NCBI)