Products 3695-80-5
CAS 3695-80-5 appears in our catalog under these names: H–Ala–D–Ala–OH, H-Ala-d-ala-oh, 95%, Ala-D-Ala-OH, H-Ala-D-Ala-OH 98%, H-ALA-D-ALA-OH, 98%, 98%. Offered by: GLPBio, Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 50mg, 500mg, 1000mg, 25 mg.
(2R)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid (CAS 3695-80-5) is a chemical compound with the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. IUPAC name: (2R)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid. InChIKey: DEFJQIDDEAULHB-IUYQGCFVSA-N.
| Molecular formula | C6H12N2O3 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (2R)-2-[[(2S)-2-aminopropanoyl]amino]propanoic acid |
| InChIKey | DEFJQIDDEAULHB-IUYQGCFVSA-N |
| SMILES | C[C@@H](C(=O)N[C@H](C)C(=O)O)N |
Computed by PubChem (NCBI)