CAS 59247-16-4 appears in our catalog under these names: DL-alanyl-l-alanine, 95%, DL–Alanyl–L–alanine, DL-Alanyl-L-alanine, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2S)-2-(2-aminopropanoylamino)propanoic acid (CAS 59247-16-4) is a chemical compound with the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. IUPAC name: (2S)-2-(2-aminopropanoylamino)propanoic acid. InChIKey: DEFJQIDDEAULHB-BKLSDQPFSA-N.
| Molecular formula | C6H12N2O3 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (2S)-2-(2-aminopropanoylamino)propanoic acid |
| InChIKey | DEFJQIDDEAULHB-BKLSDQPFSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)C(C)N |
Computed by PubChem (NCBI)