CAS 90760-70-6 is the registry number for D-Alanyl-L-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoic acid (CAS 90760-70-6) is a chemical compound with the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. IUPAC name: (2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoic acid. InChIKey: DEFJQIDDEAULHB-DMTCNVIQSA-N.
| Molecular formula | C6H12N2O3 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoic acid |
| InChIKey | DEFJQIDDEAULHB-DMTCNVIQSA-N |
| SMILES | C[C@H](C(=O)N[C@@H](C)C(=O)O)N |
Computed by PubChem (NCBI)