Products 37010-48-3

CAS 37010-48-3 is the registry number for 1-(3,5-Dimethylphenyl)pyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-(3,5-dimethylphenyl)pyrrolidine-2,5-dione (CAS 37010-48-3) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)pyrrolidine-2,5-dione. InChIKey: OOLSLUHREGCXLL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO2
Molecular weight203.24 g/mol
IUPAC name1-(3,5-dimethylphenyl)pyrrolidine-2,5-dione
InChIKeyOOLSLUHREGCXLL-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)N2C(=O)CCC2=O)C

Computed by PubChem (NCBI)