CAS 37010-48-3 is the registry number for 1-(3,5-Dimethylphenyl)pyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(3,5-dimethylphenyl)pyrrolidine-2,5-dione (CAS 37010-48-3) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)pyrrolidine-2,5-dione. InChIKey: OOLSLUHREGCXLL-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)pyrrolidine-2,5-dione |
| InChIKey | OOLSLUHREGCXLL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C(=O)CCC2=O)C |
Computed by PubChem (NCBI)