Products 370582-94-8
CAS 370582-94-8 is the registry number for PSF-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,8-dihydroxy-4-(4-methoxyphenyl)chromen-2-one (CAS 370582-94-8) is a chemical compound with the molecular formula C16H12O5 and a molecular weight of 284.26 g/mol. IUPAC name: 7,8-dihydroxy-4-(4-methoxyphenyl)chromen-2-one. InChIKey: YSMHBLKPFCNMPE-UHFFFAOYSA-N.
| Molecular formula | C16H12O5 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | 7,8-dihydroxy-4-(4-methoxyphenyl)chromen-2-one |
| InChIKey | YSMHBLKPFCNMPE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)OC3=C2C=CC(=C3O)O |
Computed by PubChem (NCBI)