Products 370583-15-6
CAS 370583-15-6 is the registry number for SARS-CoV-2 Mpro-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-3-[(3E,5E)-2-oxo-6-phenylhexa-3,5-dienyl]-1H-indol-2-one (CAS 370583-15-6) is a chemical compound with the molecular formula C20H17NO3 and a molecular weight of 319.4 g/mol. IUPAC name: 3-hydroxy-3-[(3E,5E)-2-oxo-6-phenylhexa-3,5-dienyl]-1H-indol-2-one. InChIKey: MZIDKDPPIHIDQR-ZVSIBQGLSA-N.
| Molecular formula | C20H17NO3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 3-hydroxy-3-[(3E,5E)-2-oxo-6-phenylhexa-3,5-dienyl]-1H-indol-2-one |
| InChIKey | MZIDKDPPIHIDQR-ZVSIBQGLSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C(=O)CC2(C3=CC=CC=C3NC2=O)O |
Computed by PubChem (NCBI)