CAS 37071-20-8 appears in our catalog under these names: 2-Amino-4,5-dihydronaphtho(2,1-b)thiophene-1-carbonitrile, 95%, 2-Amino-4H,5H-naphtho(2,1-b)thiophene-1-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-amino-4,5-dihydrobenzo[e][1]benzothiole-1-carbonitrile (CAS 37071-20-8) is a chemical compound with the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. IUPAC name: 2-amino-4,5-dihydrobenzo[e][1]benzothiole-1-carbonitrile. InChIKey: KMUDCZOBMKTNNP-UHFFFAOYSA-N.
| Molecular formula | C13H10N2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 2-amino-4,5-dihydrobenzo[e][1]benzothiole-1-carbonitrile |
| InChIKey | KMUDCZOBMKTNNP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)C(=C(S2)N)C#N |
Computed by PubChem (NCBI)