CAS 370879-86-0 appears in our catalog under these names: 3-Bromo-5-(2,2,2-trifluoroethoxy)pyridine, 98%, 3-Bromo-5-(2,2,2-trifluoroethoxy)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-bromo-5-(2,2,2-trifluoroethoxy)pyridine (CAS 370879-86-0) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 3-bromo-5-(2,2,2-trifluoroethoxy)pyridine. InChIKey: ZMZNDPYHFGGPTR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 3-bromo-5-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | ZMZNDPYHFGGPTR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)OCC(F)(F)F |
Computed by PubChem (NCBI)