CAS 37088-68-9 is the registry number for (S)-Methyl 3-amino-3-phenylpropanoate (2r,3r)-2,3-dihydroxysuccinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R,3R)-2,3-dihydroxybutanedioic acid;methyl (3S)-3-amino-3-phenylpropanoate (CAS 37088-68-9) is a chemical compound with the molecular formula C14H19NO8 and a molecular weight of 329.30 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;methyl (3S)-3-amino-3-phenylpropanoate. InChIKey: WLNWVUTXVXQUIZ-NDAAPVSOSA-N.
| Molecular formula | C14H19NO8 |
|---|---|
| Molecular weight | 329.30 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;methyl (3S)-3-amino-3-phenylpropanoate |
| InChIKey | WLNWVUTXVXQUIZ-NDAAPVSOSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=CC=C1)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)