Products 74213-96-0
CAS 74213-96-0 is the registry number for Thalictoside. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(hydroxymethyl)-6-[4-(2-nitroethyl)phenoxy]oxane-3,4,5-triol (CAS 74213-96-0) is a chemical compound with the molecular formula C14H19NO8 and a molecular weight of 329.30 g/mol. IUPAC name: 2-(hydroxymethyl)-6-[4-(2-nitroethyl)phenoxy]oxane-3,4,5-triol. InChIKey: JRSACOBIDKCJGV-UHFFFAOYSA-N.
| Molecular formula | C14H19NO8 |
|---|---|
| Molecular weight | 329.30 g/mol |
| IUPAC name | 2-(hydroxymethyl)-6-[4-(2-nitroethyl)phenoxy]oxane-3,4,5-triol |
| InChIKey | JRSACOBIDKCJGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(2-Nitroethyl)phenyl hexopyranoside