CAS 501684-22-6 is the registry number for Erlotinib Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate (CAS 501684-22-6) is a chemical compound with the molecular formula C14H19NO8 and a molecular weight of 329.30 g/mol. IUPAC name: methyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate. InChIKey: GTHNQCNTCCSQIW-UHFFFAOYSA-N.
| Molecular formula | C14H19NO8 |
|---|---|
| Molecular weight | 329.30 g/mol |
| IUPAC name | methyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate |
| InChIKey | GTHNQCNTCCSQIW-UHFFFAOYSA-N |
| SMILES | COCCOC1=C(C=C(C(=C1)C(=O)OC)[N+](=O)[O-])OCCOC |
Computed by PubChem (NCBI)