Products 501684-22-6

CAS 501684-22-6 is the registry number for Erlotinib Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate (CAS 501684-22-6) is a chemical compound with the molecular formula C14H19NO8 and a molecular weight of 329.30 g/mol. IUPAC name: methyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate. InChIKey: GTHNQCNTCCSQIW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO8
Molecular weight329.30 g/mol
IUPAC namemethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate
InChIKeyGTHNQCNTCCSQIW-UHFFFAOYSA-N
SMILESCOCCOC1=C(C=C(C(=C1)C(=O)OC)[N+](=O)[O-])OCCOC

Computed by PubChem (NCBI)