Products 37109-98-1
CAS 37109-98-1 is the registry number for 1-(2-Deoxy-β-D-erythro-pentofuranosyl)-4(1H)-pyrimidinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-4-one (CAS 37109-98-1) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-4-one. InChIKey: ZUPZBNPYYJNJPQ-LKEWCRSYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-4-one |
| InChIKey | ZUPZBNPYYJNJPQ-LKEWCRSYSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)N=C2)CO)O |
Computed by PubChem (NCBI)