Products 371132-32-0
CAS 371132-32-0 is the registry number for 4,6-Dimethyl-2-(methylsulfonyl)nicotinonitrile, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4,6-dimethyl-2-methylsulfonylpyridine-3-carbonitrile (CAS 371132-32-0) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 4,6-dimethyl-2-methylsulfonylpyridine-3-carbonitrile. InChIKey: FSZHPIKMYHHGLP-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 4,6-dimethyl-2-methylsulfonylpyridine-3-carbonitrile |
| InChIKey | FSZHPIKMYHHGLP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C#N)S(=O)(=O)C)C |
Computed by PubChem (NCBI)