Products 37133-76-9
CAS 37133-76-9 is the registry number for (-)-10,11-Dihydroxyfarnesol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,6E,10S)-3,7,11-trimethyldodeca-2,6-diene-1,10,11-triol (CAS 37133-76-9) is a chemical compound with the molecular formula C15H28O3 and a molecular weight of 256.38 g/mol. IUPAC name: (2E,6E,10S)-3,7,11-trimethyldodeca-2,6-diene-1,10,11-triol. InChIKey: IXWNWWMHOFVJGN-SCGYNDOXSA-N.
| Molecular formula | C15H28O3 |
|---|---|
| Molecular weight | 256.38 g/mol |
| IUPAC name | (2E,6E,10S)-3,7,11-trimethyldodeca-2,6-diene-1,10,11-triol |
| InChIKey | IXWNWWMHOFVJGN-SCGYNDOXSA-N |
| SMILES | C/C(=C\CC/C(=C/CO)/C)/CC[C@@H](C(C)(C)O)O |
Computed by PubChem (NCBI)