Products 37159-31-2
CAS 37159-31-2 appears in our catalog under these names: Clenbuterol Impurity 2, Clenbuterol Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-amino-3-chlorophenyl)-2-(tert-butylamino)ethanol (CAS 37159-31-2) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: 1-(4-amino-3-chlorophenyl)-2-(tert-butylamino)ethanol. InChIKey: UUSOUUVPVAYRPI-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | 1-(4-amino-3-chlorophenyl)-2-(tert-butylamino)ethanol |
| InChIKey | UUSOUUVPVAYRPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)N)Cl)O |
Computed by PubChem (NCBI)