CAS 3735-97-5 is the registry number for 1-(Methyl-propan-2-yloxyphosphoryl)oxy-4-nitrobenzene. Offered by: Biosynth. Available pack sizes: 50g, 25g.
1-[methyl(propan-2-yloxy)phosphoryl]oxy-4-nitrobenzene (CAS 3735-97-5) is a chemical compound with the molecular formula C10H14NO5P and a molecular weight of 259.20 g/mol. IUPAC name: 1-[methyl(propan-2-yloxy)phosphoryl]oxy-4-nitrobenzene. InChIKey: YSHVIWJFWCEDSQ-UHFFFAOYSA-N.
| Molecular formula | C10H14NO5P |
|---|---|
| Molecular weight | 259.20 g/mol |
| IUPAC name | 1-[methyl(propan-2-yloxy)phosphoryl]oxy-4-nitrobenzene |
| InChIKey | YSHVIWJFWCEDSQ-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=O)(C)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)