Products 37456-51-2
CAS 37456-51-2 is the registry number for 5,5-dimethyl-2-(2-oxo-2-phenylethyl)cyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
5,5-dimethyl-2-phenacylcyclohexane-1,3-dione (CAS 37456-51-2) is a chemical compound with the molecular formula C16H18O3 and a molecular weight of 258.31 g/mol. IUPAC name: 5,5-dimethyl-2-phenacylcyclohexane-1,3-dione. InChIKey: OOBBEPNMTKNHOM-UHFFFAOYSA-N.
| Molecular formula | C16H18O3 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 5,5-dimethyl-2-phenacylcyclohexane-1,3-dione |
| InChIKey | OOBBEPNMTKNHOM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)CC(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)