CAS 37485-99-7 is the registry number for 2-Amino-1,6-naphthyridine-3-carboxamide. Offered by: TRC. Available pack sizes: 250mg.
2-amino-1,6-naphthyridine-3-carboxamide (CAS 37485-99-7) is a chemical compound with the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. IUPAC name: 2-amino-1,6-naphthyridine-3-carboxamide. InChIKey: PNXMXOYWXFTKHC-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 2-amino-1,6-naphthyridine-3-carboxamide |
| InChIKey | PNXMXOYWXFTKHC-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=C(N=C21)N)C(=O)N |
Computed by PubChem (NCBI)