CAS 37535-49-2 appears in our catalog under these names: L-4-Pyridylalanine, 98%, H–D–Ala(4–pyridyl)–OH?HCl, H-L-4Pal-OH*HCl, 3-(4'-Pyridyl)-L-alanine, 3-(4-PYRIDYL)-L-ALANINE. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 100mg, 250mg.
(2S)-2-amino-3-pyridin-4-ylpropanoic acid (CAS 37535-49-2) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: (2S)-2-amino-3-pyridin-4-ylpropanoic acid. InChIKey: FQFVANSXYKWQOT-ZETCQYMHSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2S)-2-amino-3-pyridin-4-ylpropanoic acid |
| InChIKey | FQFVANSXYKWQOT-ZETCQYMHSA-N |
| SMILES | C1=CN=CC=C1C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)