CAS 37535-50-5 appears in our catalog under these names: 3–(4–Pyridyl)–D–alanine, (R)-2-Amino-3-(pyridin-4-yl)propanoic acid, 98%, 98%, (R)-2-Amino-3-(pyridin-4-yl)propanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
(2R)-2-amino-3-pyridin-4-ylpropanoic acid (CAS 37535-50-5) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: (2R)-2-amino-3-pyridin-4-ylpropanoic acid. InChIKey: FQFVANSXYKWQOT-SSDOTTSWSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2R)-2-amino-3-pyridin-4-ylpropanoic acid |
| InChIKey | FQFVANSXYKWQOT-SSDOTTSWSA-N |
| SMILES | C1=CN=CC=C1C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)