CAS 37535-51-6 appears in our catalog under these names: 3–(2–Pyridyl)–Alanine, H-L-2Pal-OH, 3-(2-Pyridyl)-L-alanine, H-2-Pal-OH, 98%, 98%, 3-(2-PYRIDYL)-L-ALANINE, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 100mg, 250mg, 10g.
(2S)-2-amino-3-pyridin-2-ylpropanoic acid (CAS 37535-51-6) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: (2S)-2-amino-3-pyridin-2-ylpropanoic acid. InChIKey: PDRJLZDUOULRHE-ZETCQYMHSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2S)-2-amino-3-pyridin-2-ylpropanoic acid |
| InChIKey | PDRJLZDUOULRHE-ZETCQYMHSA-N |
| SMILES | C1=CC=NC(=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)