CAS 37535-52-7 appears in our catalog under these names: 3-(2-Pyridyl)-D-Alanine.2HCl, 95%, H–D–Ala(2–pyridyl)–OH?2HCl, 3–(2–Pyridyl)–D–Alanine, H-D-2Pal-OH*2HCl, 3-(2-Pyridyl)-D-alanine. Offered by: Chemat Brand, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 25g, 5g, 100g, 10 g, 5 g, 1 g.
(2R)-2-amino-3-pyridin-2-ylpropanoic acid (CAS 37535-52-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: (2R)-2-amino-3-pyridin-2-ylpropanoic acid. InChIKey: PDRJLZDUOULRHE-SSDOTTSWSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2R)-2-amino-3-pyridin-2-ylpropanoic acid |
| InChIKey | PDRJLZDUOULRHE-SSDOTTSWSA-N |
| SMILES | C1=CC=NC(=C1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)