CAS 37545-92-9 appears in our catalog under these names: 1-Oxaspiro[2.5]octane, 2-phenyl-, 95%+, 95%+, 2-phenyl-1-oxaspiro[2.5]octane, 95%+. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg.
2-phenyl-1-oxaspiro[2.5]octane (CAS 37545-92-9) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 2-phenyl-1-oxaspiro[2.5]octane. InChIKey: NEVVTFWFRCKGLF-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 2-phenyl-1-oxaspiro[2.5]octane |
| InChIKey | NEVVTFWFRCKGLF-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)