Products 37572-21-7

CAS 37572-21-7 is the registry number for Methyl 3-amino-5-(4-methylphenyl)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-5-(4-methylphenyl)thiophene-2-carboxylate (CAS 37572-21-7) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: methyl 3-amino-5-(4-methylphenyl)thiophene-2-carboxylate. InChIKey: WRVIBRNCJCBFCI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO2S
Molecular weight247.31 g/mol
IUPAC namemethyl 3-amino-5-(4-methylphenyl)thiophene-2-carboxylate
InChIKeyWRVIBRNCJCBFCI-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=CC(=C(S2)C(=O)OC)N

Computed by PubChem (NCBI)