CAS 375834-47-2 is the registry number for 6-(4-Hydroxyphenyl)-2-thioxo-2,3-dihydropyrimidin-4(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
6-(4-hydroxyphenyl)-2-sulfanylidene-1H-pyrimidin-4-one (CAS 375834-47-2) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 6-(4-hydroxyphenyl)-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: WPNGNGKVFAIABV-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 6-(4-hydroxyphenyl)-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | WPNGNGKVFAIABV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)NC(=S)N2)O |
Computed by PubChem (NCBI)