CAS 375857-96-8 is the registry number for 1-(3-Bromophenyl)-1H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-bromophenyl)-1,2,4-triazole (CAS 375857-96-8) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 1-(3-bromophenyl)-1,2,4-triazole. InChIKey: YJQBLWWHFYAXRA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 1-(3-bromophenyl)-1,2,4-triazole |
| InChIKey | YJQBLWWHFYAXRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=NC=N2 |
Computed by PubChem (NCBI)